Cyclohexanol,2,2-dimethoxy-, 1-benzoate
Cyclohexanol,2,2-dimethoxy-, 1-benzoate structure
|
Common Name | Cyclohexanol,2,2-dimethoxy-, 1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 7472-22-2 | Molecular Weight | 264.31700 | |
| Density | 1.12g/cm3 | Boiling Point | 341.5ºC at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,2-dimethoxycyclohexyl) benzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 341.5ºC at 760 mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 147.2ºC |
| Exact Mass | 264.13600 |
| PSA | 44.76000 |
| LogP | 2.77510 |
| Index of Refraction | 1.52 |
| InChIKey | QCHZLWFHCGPREO-UHFFFAOYSA-N |
| SMILES | COC1(OC)CCCCC1OC(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Cyclohexanol,2,... CAS#:7472-22-2 |
| Literature: Stevens; Tazuma Journal of the American Chemical Society, 1954 , vol. 76, p. 715 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-benzoyloxy-1,1-dimethoxy-cyclohexane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (2,2-dimethoxycyclohexyl) benzoate? |
| A: Molecular weight of (2,2-dimethoxycyclohexyl) benzoate is 264.31700. |
| Q: What is the polar surface area (PSA) of (2,2-dimethoxycyclohexyl) benzoate? |
| A: Polar surface area (PSA) of (2,2-dimethoxycyclohexyl) benzoate is 44.76000. |
| Q: What is the Chinese name of 7472-22-2? |
| A: Chinese name of 7472-22-2 is 7472-22-2. |
| Q: What is the SMILES notation of (2,2-dimethoxycyclohexyl) benzoate? |
| A: SMILES notation of (2,2-dimethoxycyclohexyl) benzoate is COC1(OC)CCCCC1OC(=O)c1ccccc1. |
| Q: What is the LogP of (2,2-dimethoxycyclohexyl) benzoate? |
| A: LogP of (2,2-dimethoxycyclohexyl) benzoate is 2.77510. |
| Q: What English synonyms does (2,2-dimethoxycyclohexyl) benzoate have? |
| A: English synonyms of (2,2-dimethoxycyclohexyl) benzoate: 2-benzoyloxy-1,1-dimethoxy-cyclohexane. |
| Q: What are the upstream materials of (2,2-dimethoxycyclohexyl) benzoate? |
| A: Related upstream materials(CAS) of (2,2-dimethoxycyclohexyl) benzoate: 98-88-4. |
| Q: What is the CAS number of (2,2-dimethoxycyclohexyl) benzoate? |
| A: CAS number of (2,2-dimethoxycyclohexyl) benzoate is 7472-22-2. |
| Q: What is the English name of (2,2-dimethoxycyclohexyl) benzoate? |
| A: The English name of (2,2-dimethoxycyclohexyl) benzoate is (2,2-dimethoxycyclohexyl) benzoate. |
| Q: What is the boiling point of (2,2-dimethoxycyclohexyl) benzoate? |
| A: Boiling point of (2,2-dimethoxycyclohexyl) benzoate is 341.5ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |