Cyclohexanol,2,2-dimethoxy-, 1-benzoate structure
|
Common Name | Cyclohexanol,2,2-dimethoxy-, 1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 7472-22-2 | Molecular Weight | 264.31700 | |
| Density | 1.12g/cm3 | Boiling Point | 341.5ºC at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.2ºC | |
| Name | (2,2-dimethoxycyclohexyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 341.5ºC at 760 mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 147.2ºC |
| Exact Mass | 264.13600 |
| PSA | 44.76000 |
| LogP | 2.77510 |
| Index of Refraction | 1.52 |
| InChIKey | QCHZLWFHCGPREO-UHFFFAOYSA-N |
| SMILES | COC1(OC)CCCCC1OC(=O)c1ccccc1 |
|
~%
Cyclohexanol,2,... CAS#:7472-22-2 |
| Literature: Stevens; Tazuma Journal of the American Chemical Society, 1954 , vol. 76, p. 715 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-benzoyloxy-1,1-dimethoxy-cyclohexane |