Benzamide,N-(4-chlorocyclohexyl)
Modify Date: 2026-04-07 23:22:30
Benzamide,N-(4-chlorocyclohexyl) structure
|
Common Name | Benzamide,N-(4-chlorocyclohexyl) | ||
|---|---|---|---|---|
| CAS Number | 7472-31-3 | Molecular Weight | 237.72500 | |
| Density | 1.16g/cm3 | Boiling Point | 436.4ºC at 760 mmHg | |
| Molecular Formula | C13H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.7ºC | |
| Name | N-(4-chlorocyclohexyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 436.4ºC at 760 mmHg |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.72500 |
| Flash Point | 217.7ºC |
| Exact Mass | 237.09200 |
| PSA | 29.10000 |
| LogP | 3.35730 |
| Index of Refraction | 1.557 |
| InChIKey | UPZZASHHAUVGLL-UHFFFAOYSA-N |
| SMILES | O=C(NC1CCC(Cl)CC1)c1ccccc1 |
|
~%
Benzamide,N-(4-... CAS#:7472-31-3 |
| Literature: Stevens; Farkas Journal of the American Chemical Society, 1953 , vol. 75, p. 3306 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-(4-chloro-cyclohexyl)-benzamide |
| N-(4-Chlor-cyclohexyl)-benzamid |