[2-methyl-1-oxo-1-(4-phenylphenyl)propan-2-yl] 3,5-dinitrobenzoate structure
|
Common Name | [2-methyl-1-oxo-1-(4-phenylphenyl)propan-2-yl] 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 7472-40-4 | Molecular Weight | 434.39800 | |
| Density | 1.335g/cm3 | Boiling Point | 631.3ºC at 760 mmHg | |
| Molecular Formula | C23H18N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | [2-methyl-1-oxo-1-(4-phenylphenyl)propan-2-yl] 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 631.3ºC at 760 mmHg |
| Molecular Formula | C23H18N2O7 |
| Molecular Weight | 434.39800 |
| Flash Point | 251.5ºC |
| Exact Mass | 434.11100 |
| PSA | 135.01000 |
| LogP | 6.03470 |
| Index of Refraction | 1.621 |
| InChIKey | VJMFVNDKJQUPDN-UHFFFAOYSA-N |
| SMILES | CC(C)(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
[2-methyl-1-oxo... CAS#:7472-40-4 |
| Literature: Stevens; Dykstra Journal of the American Chemical Society, 1953 , vol. 75, p. 5975,5977 |
|
~%
[2-methyl-1-oxo... CAS#:7472-40-4 |
| Literature: Stevens; Dykstra Journal of the American Chemical Society, 1953 , vol. 75, p. 5975,5977 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-biphenyl-4-yl-2-(3,5-dinitro-benzoyloxy)-2-methyl-propan-1-one |