N-(2-nitrophenyl)-2,2-diphenyl-acetamide structure
|
Common Name | N-(2-nitrophenyl)-2,2-diphenyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 7472-60-8 | Molecular Weight | 332.35300 | |
| Density | 1.283g/cm3 | Boiling Point | 562.8ºC at 760 mmHg | |
| Molecular Formula | C20H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2ºC | |
| Name | N-(2-nitrophenyl)-2,2-diphenylacetamide |
|---|
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 562.8ºC at 760 mmHg |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.35300 |
| Flash Point | 294.2ºC |
| Exact Mass | 332.11600 |
| PSA | 74.92000 |
| LogP | 4.96160 |
| Index of Refraction | 1.663 |
| InChIKey | VQVPXVSXCUONNS-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])C(c1ccccc1)c1ccccc1 |
|
~%
N-(2-nitropheny... CAS#:7472-60-8 |
| Literature: Charton, Julie; Girault-Mizzi, Sophie; Sergheraert, Christian Chemical and Pharmaceutical Bulletin, 2005 , vol. 53, # 5 p. 492 - 497 |
|
~%
N-(2-nitropheny... CAS#:7472-60-8 |
| Literature: Charton, Julie; Girault-Mizzi, Sophie; Debreu-Fontaine, Marie-Ange; Foufelle, Fabienne; Hainault, Isabelle; Bizot-Espiard, Jean-Guy; Caignard, Daniel-Henri; Sergheraert, Christian Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 13 p. 4490 - 4518 |
|
~%
N-(2-nitropheny... CAS#:7472-60-8 |
| Literature: van Alphen Recueil des Travaux Chimiques des Pays-Bas, 1924 , vol. 43, p. 853 |