(3,4-dibromo-1-oxo-1,3-diphenyl-butan-2-yl) benzoate structure
|
Common Name | (3,4-dibromo-1-oxo-1,3-diphenyl-butan-2-yl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 7472-85-7 | Molecular Weight | 502.19500 | |
| Density | 1.547g/cm3 | Boiling Point | 613.8ºC at 760 mmHg | |
| Molecular Formula | C23H18Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325ºC | |
| Name | (3,4-dibromo-1-oxo-1,3-diphenylbutan-2-yl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.547g/cm3 |
|---|---|
| Boiling Point | 613.8ºC at 760 mmHg |
| Molecular Formula | C23H18Br2O3 |
| Molecular Weight | 502.19500 |
| Flash Point | 325ºC |
| Exact Mass | 499.96200 |
| PSA | 43.37000 |
| LogP | 5.78020 |
| Index of Refraction | 1.636 |
| InChIKey | NLZAFGNKCZTZLP-UHFFFAOYSA-N |
| SMILES | O=C(OC(C(=O)c1ccccc1)C(Br)(CBr)c1ccccc1)c1ccccc1 |
|
~%
(3,4-dibromo-1-... CAS#:7472-85-7 |
| Literature: Stevens; Hiskey Journal of Organic Chemistry, 1959 , vol. 24, p. 32,36 |
|
~%
(3,4-dibromo-1-... CAS#:7472-85-7 |
| Literature: Stevens; Hiskey Journal of Organic Chemistry, 1959 , vol. 24, p. 32,36 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2RS,3SR)-2-benzoyloxy-3,4-dibromo-1,3-diphenyl-butan-1-one |
| (2RS,3SR)-2-Benzoyloxy-3,4-dibrom-1,3-diphenyl-butan-1-on |