Benzeneacetamide,N-(2,2-diphenylacetyl)-N-(4-methylphenyl)-a-phenyl structure
|
Common Name | Benzeneacetamide,N-(2,2-diphenylacetyl)-N-(4-methylphenyl)-a-phenyl | ||
|---|---|---|---|---|
| CAS Number | 7472-87-9 | Molecular Weight | 495.61000 | |
| Density | 1.179g/cm3 | Boiling Point | 716.7ºC at 760mmHg | |
| Molecular Formula | C35H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.4ºC | |
| Name | N-(2,2-diphenylacetyl)-N-(4-methylphenyl)-2,2-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 716.7ºC at 760mmHg |
| Molecular Formula | C35H29NO2 |
| Molecular Weight | 495.61000 |
| Flash Point | 309.4ºC |
| Exact Mass | 495.22000 |
| PSA | 37.38000 |
| LogP | 7.51880 |
| Index of Refraction | 1.646 |
| InChIKey | YDRGATPCEUGXNJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(C(=O)C(c2ccccc2)c2ccccc2)C(=O)C(c2ccccc2)c2ccccc2)cc1 |
|
~%
Benzeneacetamid... CAS#:7472-87-9 |
| Literature: Stevens; Munk Journal of the American Chemical Society, 1958 , vol. 80, p. 4069 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-bis-diphenylacetyl-p-toluidine |