N-(2,2-diphenylacetyl)-2,4,6-trimethyl-N-(4-methylphenyl)benzamide structure
|
Common Name | N-(2,2-diphenylacetyl)-2,4,6-trimethyl-N-(4-methylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 7472-92-6 | Molecular Weight | 447.56700 | |
| Density | 1.147g/cm3 | Boiling Point | 634.6ºC at 760 mmHg | |
| Molecular Formula | C31H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.9ºC | |
| Name | N-(2,2-diphenylacetyl)-2,4,6-trimethyl-N-(4-methylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 634.6ºC at 760 mmHg |
| Molecular Formula | C31H29NO2 |
| Molecular Weight | 447.56700 |
| Flash Point | 266.9ºC |
| Exact Mass | 447.22000 |
| PSA | 37.38000 |
| LogP | 6.92570 |
| Index of Refraction | 1.627 |
| InChIKey | KFKRYRQSEOINTF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(C(=O)c2c(C)cc(C)cc2C)C(=O)C(c2ccccc2)c2ccccc2)cc1 |
|
~%
N-(2,2-diphenyl... CAS#:7472-92-6 |
| Literature: Stevens; Munk Journal of the American Chemical Society, 1958 , vol. 80, p. 4069 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-diphenylacetyl-N-(2,4,6-trimethyl-benzoyl)-p-toluidine |