N-[1-(anilinocarbamoyl)-3-methylsulfanyl-propyl]-1-phenyl-methanesulfonamide structure
|
Common Name | N-[1-(anilinocarbamoyl)-3-methylsulfanyl-propyl]-1-phenyl-methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7474-67-1 | Molecular Weight | 393.52400 | |
| Density | 1.301g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H23N3O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-methylsulfanyl-1-oxo-1-(2-phenylhydrazinyl)butan-2-yl]-1-phenylmethanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Molecular Formula | C18H23N3O3S2 |
| Molecular Weight | 393.52400 |
| Exact Mass | 393.11800 |
| PSA | 120.98000 |
| LogP | 4.30660 |
| Index of Refraction | 1.626 |
| InChIKey | CPXZSUSONKKSLT-UHFFFAOYSA-N |
| SMILES | CSCCC(NS(=O)(=O)Cc1ccccc1)C(=O)NNc1ccccc1 |
|
~%
N-[1-(anilinoca... CAS#:7474-67-1 |
| Literature: Milne; Peng Journal of the American Chemical Society, 1957 , vol. 79, p. 639,642 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-phenylmethanesulfonyl-L-methionine-(N'-phenyl-hydrazide) |
| N-Phenylmethansulfonyl-L-methionin-(N'-phenyl-hydrazid) |
| N-phenylmethanesulfonyl-glycine-(N'-phenyl-hydrazide) |
| N-Phenylmethansulfonyl-glycin-(N'-phenyl-hydrazid) |