2,3-dichloronaphthalene-1,4-diol structure
|
Common Name | 2,3-dichloronaphthalene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 7474-86-4 | Molecular Weight | 229.05900 | |
| Density | 1.587g/cm3 | Boiling Point | 391.5ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.6ºC | |
| Name | 2,3-dichloronaphthalene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.587g/cm3 |
|---|---|
| Boiling Point | 391.5ºC at 760 mmHg |
| Molecular Formula | C10H6Cl2O2 |
| Molecular Weight | 229.05900 |
| Flash Point | 190.6ºC |
| Exact Mass | 227.97400 |
| PSA | 40.46000 |
| LogP | 3.55780 |
| Index of Refraction | 1.73 |
| InChIKey | NSMQVSICUVTJPT-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)c(Cl)c(O)c2ccccc12 |
|
~42%
2,3-dichloronap... CAS#:7474-86-4 |
| Literature: Kulkarni, Mukund G.; Kate, Sandesh D. Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 24 p. 4242 - 4244 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1,4-Naphthalenediol,2,3-dichloro |
| 2,3-Dichloro-1,4-naphthalenediol |
| 2,3-Dichlor-naphthalin-1,4-diol |
| 2,3-dichloro-naphthalene-1,4-diol |
| 2,3-Dichlor-1,4-naphthohydrochinon |
| 2,3-dichloro-1,4-dihydroxynaphthalene |