2-[(2-acetyloxyphenyl)methylidene]propanedioic acid structure
|
Common Name | 2-[(2-acetyloxyphenyl)methylidene]propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 7475-02-7 | Molecular Weight | 250.20400 | |
| Density | 1.441g/cm3 | Boiling Point | 456.2ºC at 760 mmHg | |
| Molecular Formula | C12H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.5ºC | |
| Name | 2-[(2-acetyloxyphenyl)methylidene]propanedioic acid |
|---|
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 456.2ºC at 760 mmHg |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.20400 |
| Flash Point | 178.5ºC |
| Exact Mass | 250.04800 |
| PSA | 100.90000 |
| LogP | 1.16450 |
| Index of Refraction | 1.621 |
| InChIKey | KKPBBYXBMUJZFQ-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1C=C(C(=O)O)C(=O)O |
|
~%
2-[(2-acetyloxy... CAS#:7475-02-7 |
| Literature: Michael; Weiner Journal of the American Chemical Society, 1936 , vol. 58, p. 680,683 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |