2-nitro-1,1-diphenyl-ethanol structure
|
Common Name | 2-nitro-1,1-diphenyl-ethanol | ||
|---|---|---|---|---|
| CAS Number | 7475-15-2 | Molecular Weight | 243.25800 | |
| Density | 1.238g/cm3 | Boiling Point | 424.7ºC at 760 mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-nitro-1,1-diphenylethanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 424.7ºC at 760 mmHg |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.25800 |
| Flash Point | 179.8ºC |
| Exact Mass | 243.09000 |
| PSA | 66.05000 |
| LogP | 2.72240 |
| Index of Refraction | 1.601 |
| InChIKey | VFWPBQCWPLTKBX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CC(O)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 10 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Nitro-1,1-diphenyl-aethanol |
| 2-Nitro-1-hydroxy-1.1-diphenyl-aethan |
| 2-nitro-1,1-diphenyl-ethanol |
| 1,1-diphenyl-2-nitroethanol |
| 1,1-diphenyl-2-nitro-1-ethanol |
| 2,2-diphenyl-2-hydroxy-1-nitroethane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-nitro-1,1-diphenylethanol? |
| A: Polar surface area (PSA) of 2-nitro-1,1-diphenylethanol is 66.05000. |
| Q: What is the boiling point of 2-nitro-1,1-diphenylethanol? |
| A: Boiling point of 2-nitro-1,1-diphenylethanol is 424.7ºC at 760 mmHg. |
| Q: What is the SMILES notation of 2-nitro-1,1-diphenylethanol? |
| A: SMILES notation of 2-nitro-1,1-diphenylethanol is O=[N+]([O-])CC(O)(c1ccccc1)c1ccccc1. |
| Q: What is the InChIKey of 2-nitro-1,1-diphenylethanol? |
| A: InChIKey of 2-nitro-1,1-diphenylethanol is VFWPBQCWPLTKBX-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-nitro-1,1-diphenylethanol? |
| A: LogP of 2-nitro-1,1-diphenylethanol is 2.72240. |
| Q: What is the English name of 2-nitro-1,1-diphenylethanol? |
| A: The English name of 2-nitro-1,1-diphenylethanol is 2-nitro-1,1-diphenylethanol. |
| Q: What is the CAS number of 2-nitro-1,1-diphenylethanol? |
| A: CAS number of 2-nitro-1,1-diphenylethanol is 7475-15-2. |
| Q: What are the upstream materials of 2-nitro-1,1-diphenylethanol? |
| A: Related upstream materials(CAS) of 2-nitro-1,1-diphenylethanol: 530-48-3;599-67-7;19244-53-2;612-00-0;7697-37-2;64-19-7;56-23-5. |
| Q: What is the molecular weight of 2-nitro-1,1-diphenylethanol? |
| A: Molecular weight of 2-nitro-1,1-diphenylethanol is 243.25800. |
| Q: What English synonyms does 2-nitro-1,1-diphenylethanol have? |
| A: English synonyms of 2-nitro-1,1-diphenylethanol: 2-Nitro-1,1-diphenyl-aethanol, 2-Nitro-1-hydroxy-1.1-diphenyl-aethan, 2-nitro-1,1-diphenyl-ethanol, 1,1-diphenyl-2-nitroethanol, 1,1-diphenyl-2-nitro-1-ethanol, 2,2-diphenyl-2-hydroxy-1-nitroethane. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |