Glycine,N-[(phenylmethyl)sulfonyl]-, 2-phenylhydrazide structure
|
Common Name | Glycine,N-[(phenylmethyl)sulfonyl]-, 2-phenylhydrazide | ||
|---|---|---|---|---|
| CAS Number | 7475-18-5 | Molecular Weight | 319.37900 | |
| Density | 1.339g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-oxo-2-(2-phenylhydrazinyl)ethyl]-1-phenylmethanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.37900 |
| Exact Mass | 319.09900 |
| PSA | 95.68000 |
| LogP | 3.18490 |
| Index of Refraction | 1.633 |
| InChIKey | DXCUNBGVJKJJGW-UHFFFAOYSA-N |
| SMILES | O=C(CNS(=O)(=O)Cc1ccccc1)NNc1ccccc1 |
|
~%
Glycine,N-[(phe... CAS#:7475-18-5 |
| Literature: Milne; Peng Journal of the American Chemical Society, 1957 , vol. 79, p. 639,642 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Phenylmethansulfonyl-glycin-(N'-phenyl-hydrazid) |
| N-phenylmethanesulfonyl-glycine-(N'-phenyl-hydrazide) |