1,2-Anthracenedicarboxylicacid, 9,10-dihydro-9,10-dioxo structure
|
Common Name | 1,2-Anthracenedicarboxylicacid, 9,10-dihydro-9,10-dioxo | ||
|---|---|---|---|---|
| CAS Number | 7475-29-8 | Molecular Weight | 296.23100 | |
| Density | 1.608g/cm3 | Boiling Point | 621.6ºC at 760 mmHg | |
| Molecular Formula | C16H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.7ºC | |
| Name | 1,2-Anthraquinonedicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.608g/cm3 |
|---|---|
| Boiling Point | 621.6ºC at 760 mmHg |
| Molecular Formula | C16H8O6 |
| Molecular Weight | 296.23100 |
| Flash Point | 343.7ºC |
| Exact Mass | 296.03200 |
| PSA | 108.74000 |
| LogP | 1.85840 |
| Index of Refraction | 1.717 |
| InChIKey | QQPQYWGNVMIGAF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1C(=O)O)C(=O)c1ccccc1C2=O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9,10-dioxo-9,10-dihydro-anthracene-1,2-dicarboxylic acid |
| Anthraquinonedicarboxylic acid |
| 9,10-dioxoanthracene-1,2-dicarboxylic acid |
| 9,10-Dioxo-9,10-dihydro-anthracen-1,2-dicarbonsaeure |
| Anthrachinon-1,2-dicarbonsaeure |