1,2-Anthracenedicarboxylicacid, 9,10-dihydro-9,10-dioxo
1,2-Anthracenedicarboxylicacid, 9,10-dihydro-9,10-dioxo structure
|
Common Name | 1,2-Anthracenedicarboxylicacid, 9,10-dihydro-9,10-dioxo | ||
|---|---|---|---|---|
| CAS Number | 7475-29-8 | Molecular Weight | 296.23100 | |
| Density | 1.608g/cm3 | Boiling Point | 621.6ºC at 760 mmHg | |
| Molecular Formula | C16H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Anthraquinonedicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.608g/cm3 |
|---|---|
| Boiling Point | 621.6ºC at 760 mmHg |
| Molecular Formula | C16H8O6 |
| Molecular Weight | 296.23100 |
| Flash Point | 343.7ºC |
| Exact Mass | 296.03200 |
| PSA | 108.74000 |
| LogP | 1.85840 |
| Index of Refraction | 1.717 |
| InChIKey | QQPQYWGNVMIGAF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1C(=O)O)C(=O)c1ccccc1C2=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918300090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:860730-67-2
CAS#:2498-66-0
CAS#:7664-93-9
CAS#:7697-37-2
CAS#:128-64-3
CAS#:3285-98-1
CAS#:64-19-7
CAS#:7732-18-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-dioxo-9,10-dihydro-anthracene-1,2-dicarboxylic acid |
| Anthraquinonedicarboxylic acid |
| 9,10-dioxoanthracene-1,2-dicarboxylic acid |
| 9,10-Dioxo-9,10-dihydro-anthracen-1,2-dicarbonsaeure |
| Anthrachinon-1,2-dicarbonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1,2-Anthraquinonedicarboxylic acid? |
| A: Related upstream materials(CAS) of 1,2-Anthraquinonedicarboxylic acid: 860730-67-2;2498-66-0;7664-93-9;7697-37-2;128-64-3;3285-98-1;64-19-7;7732-18-5. |
| Q: What is the molecular formula of 1,2-Anthraquinonedicarboxylic acid? |
| A: Molecular formula of 1,2-Anthraquinonedicarboxylic acid is C16H8O6. |
| Q: What is the InChIKey of 1,2-Anthraquinonedicarboxylic acid? |
| A: InChIKey of 1,2-Anthraquinonedicarboxylic acid is QQPQYWGNVMIGAF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 7475-29-8? |
| A: Chinese name of 7475-29-8 is 7475-29-8. |
| Q: What is the boiling point of 1,2-Anthraquinonedicarboxylic acid? |
| A: Boiling point of 1,2-Anthraquinonedicarboxylic acid is 621.6ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 1,2-Anthraquinonedicarboxylic acid? |
| A: Polar surface area (PSA) of 1,2-Anthraquinonedicarboxylic acid is 108.74000. |
| Q: What is the LogP of 1,2-Anthraquinonedicarboxylic acid? |
| A: LogP of 1,2-Anthraquinonedicarboxylic acid is 1.85840. |
| Q: What is the molecular weight of 1,2-Anthraquinonedicarboxylic acid? |
| A: Molecular weight of 1,2-Anthraquinonedicarboxylic acid is 296.23100. |
| Q: What is the SMILES notation of 1,2-Anthraquinonedicarboxylic acid? |
| A: SMILES notation of 1,2-Anthraquinonedicarboxylic acid is O=C(O)c1ccc2c(c1C(=O)O)C(=O)c1ccccc1C2=O. |
| Q: What English synonyms does 1,2-Anthraquinonedicarboxylic acid have? |
| A: English synonyms of 1,2-Anthraquinonedicarboxylic acid: 9,10-dioxo-9,10-dihydro-anthracene-1,2-dicarboxylic acid, Anthraquinonedicarboxylic acid, 9,10-dioxoanthracene-1,2-dicarboxylic acid, 9,10-Dioxo-9,10-dihydro-anthracen-1,2-dicarbonsaeure, Anthrachinon-1,2-dicarbonsaeure. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |