2-Anthraquinonesulfonanilide structure
|
Common Name | 2-Anthraquinonesulfonanilide | ||
|---|---|---|---|---|
| CAS Number | 7475-47-0 | Molecular Weight | 363.38700 | |
| Density | 1.464g/cm3 | Boiling Point | 602.7ºC at 760 mmHg | |
| Molecular Formula | C20H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.3ºC | |
| Name | 9,10-dioxo-N-phenylanthracene-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 602.7ºC at 760 mmHg |
| Molecular Formula | C20H13NO4S |
| Molecular Weight | 363.38700 |
| Flash Point | 318.3ºC |
| Exact Mass | 363.05700 |
| PSA | 88.69000 |
| LogP | 4.41660 |
| Index of Refraction | 1.701 |
| InChIKey | KPVHQAJENXNUQC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)Nc3ccccc3)ccc21 |
|
~%
2-Anthraquinone... CAS#:7475-47-0 |
| Literature: Buehler; Williams Journal of the American Chemical Society, 1941 , vol. 63, p. 2852 |
|
~%
2-Anthraquinone... CAS#:7475-47-0 |
| Literature: Mac Houl Chemische Berichte, 1880 , vol. 13, p. 692 |
|
~%
2-Anthraquinone... CAS#:7475-47-0 |
| Literature: Mac Houl Chemische Berichte, 1880 , vol. 13, p. 692 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| F1414-0246 |
| 2-Anthraquinonesulfonanilide |
| HMS2555M21 |
| 9,10-dioxo-N-phenyl-9,10-dihydroanthracene-2-sulfonamide |
| 9,10-dioxo-9,10-dihydro-anthracene-2-sulfonic acid anilide |
| 9,10-Dioxo-9,10-dihydro-anthracen-2-sulfonsaeure-anilid |