Formamide,N-[(1-methyl-4-phenyl-4-piperidinyl)methyl]
Modify Date: 2025-08-25 07:00:50
![Formamide,N-[(1-methyl-4-phenyl-4-piperidinyl)methyl] Structure](https://image.chemsrc.com/caspic/083/7475-58-3.png)
Formamide,N-[(1-methyl-4-phenyl-4-piperidinyl)methyl] structure
|
Common Name | Formamide,N-[(1-methyl-4-phenyl-4-piperidinyl)methyl] | ||
|---|---|---|---|---|
| CAS Number | 7475-58-3 | Molecular Weight | 232.32100 | |
| Density | 1.037g/cm3 | Boiling Point | 401.8ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.8ºC | |
| Name | N-[(1-methyl-4-phenylpiperidin-4-yl)methyl]formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.037g/cm3 |
|---|---|
| Boiling Point | 401.8ºC at 760 mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 196.8ºC |
| Exact Mass | 232.15800 |
| PSA | 32.34000 |
| LogP | 2.36070 |
| Index of Refraction | 1.526 |
| InChIKey | COFZJOJXYKQQLN-UHFFFAOYSA-N |
| SMILES | CN1CCC(CNC=O)(c2ccccc2)CC1 |
|
~%
Formamide,N-[(1... CAS#:7475-58-3 |
| Literature: Blicke; Tsao Journal of the American Chemical Society, 1953 , vol. 75, p. 5417 |
|
~%
Formamide,N-[(1... CAS#:7475-58-3 |
| Literature: Blicke; Tsao Journal of the American Chemical Society, 1953 , vol. 75, p. 5417 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(1-methyl-4-phenyl-[4]piperidylmethyl)-formamide |