ethyl 4-hydroxyimino-1-phenyl-cyclohexane-1-carboxylate
ethyl 4-hydroxyimino-1-phenyl-cyclohexane-1-carboxylate structure
|
Common Name | ethyl 4-hydroxyimino-1-phenyl-cyclohexane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 7475-62-9 | Molecular Weight | 261.31600 | |
| Density | 1.14g/cm3 | Boiling Point | 401.6ºC at 760 mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
Summary: Ethyl 4-hydroxyimino-1-phenyl-cyclohexane-1-carboxylate, Chinese name is ethyl 4-羟基咪唑-1-苯基环己烷-1-甲酸酯, CAS number is 7475-62-9, molecular formula is C15H19NO3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760 mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.31600 |
| Flash Point | 196.7ºC |
| Exact Mass | 261.13600 |
| PSA | 58.89000 |
| LogP | 2.89170 |
| Index of Refraction | 1.555 |
| InChIKey | JSGNAEIYJHTTFR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(c2ccccc2)CCC(=NO)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 4-hydroxy... CAS#:7475-62-9 |
| Literature: Rubin; Wishinsky Journal of the American Chemical Society, 1946 , vol. 68, p. 828,831 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Hydroxyimino-1-phenyl-cyclohexancarbonsaeure-aethylester |
| ETHYL 4-HYDROXYIMINO-1-PHENYL-CYCLOHEXANE-1-CARBOXYLATE |
| 4-hydroxyimino-1-phenyl-cyclohexanecarboxylic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate have? |
| A: English synonyms of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate: 4-Hydroxyimino-1-phenyl-cyclohexancarbonsaeure-aethylester, ETHYL 4-HYDROXYIMINO-1-PHENYL-CYCLOHEXANE-1-CARBOXYLATE, 4-hydroxyimino-1-phenyl-cyclohexanecarboxylic acid ethyl ester. |
| Q: What is the CAS number of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate? |
| A: CAS number of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate is 7475-62-9. |
| Q: What is the boiling point of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate? |
| A: Boiling point of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate is 401.6ºC at 760 mmHg. |
| Q: What is the molecular formula of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate? |
| A: Molecular formula of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate is C15H19NO3. |
| Q: What is the SMILES notation of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate? |
| A: SMILES notation of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate is CCOC(=O)C1(c2ccccc2)CCC(=NO)CC1. |
| Q: What is the polar surface area (PSA) of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate? |
| A: Polar surface area (PSA) of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate is 58.89000. |
| Q: What are the upstream materials of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate? |
| A: Related upstream materials(CAS) of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate: 108299-25-8. |
| Q: What is the English name of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate? |
| A: The English name of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate is ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate. |
| Q: What is the molecular weight of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate? |
| A: Molecular weight of ethyl 4-hydroxyimino-1-phenylcyclohexane-1-carboxylate is 261.31600. |
| Q: What is the Chinese name of 7475-62-9? |
| A: Chinese name of 7475-62-9 is 7475-62-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |