2,2-diphenylethyl 3,5-dinitrobenzoate structure
|
Common Name | 2,2-diphenylethyl 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 7475-76-5 | Molecular Weight | 392.36200 | |
| Density | 1.343g/cm3 | Boiling Point | 577.2ºC at 760 mmHg | |
| Molecular Formula | C21H16N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.8ºC | |
| Name | 2,2-diphenylethyl 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 577.2ºC at 760 mmHg |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.36200 |
| Flash Point | 234.8ºC |
| Exact Mass | 392.10100 |
| PSA | 117.94000 |
| LogP | 5.53830 |
| Index of Refraction | 1.635 |
| InChIKey | LDYMMDNLSXXRPV-UHFFFAOYSA-N |
| SMILES | O=C(OCC(c1ccccc1)c1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~%
2,2-diphenyleth... CAS#:7475-76-5 |
| Literature: Kharasch; Clapp Journal of Organic Chemistry, 1938 , vol. 3, p. 355,359 |
|
~%
2,2-diphenyleth... CAS#:7475-76-5 |
| Literature: Kharasch; Clapp Journal of Organic Chemistry, 1938 , vol. 3, p. 355,359 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,5-dinitro-benzoic acid-(2,2-diphenyl-ethyl ester) |
| 3,5-Dinitro-benzoesaeure-(2,2-diphenyl-aethylester) |