Benzenepropanoic acid, a-hydroxy-a,b-diphenyl-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, a-hydroxy-a,b-diphenyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7476-16-6 | Molecular Weight | 346.41900 | |
| Density | 1.161g/cm3 | Boiling Point | 465.3ºC at 760mmHg | |
| Molecular Formula | C23H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7ºC | |
| Name | ethyl 2-hydroxy-2,3,3-triphenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 465.3ºC at 760mmHg |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.41900 |
| Flash Point | 183.7ºC |
| Exact Mass | 346.15700 |
| PSA | 46.53000 |
| LogP | 4.26940 |
| Index of Refraction | 1.596 |
| InChIKey | UGLAEOZQZPSKFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(O)(c1ccccc1)C(c1ccccc1)c1ccccc1 |
|
~%
Benzenepropanoi... CAS#:7476-16-6 |
| Literature: Curtin; Proops Journal of the American Chemical Society, 1954 , vol. 76, p. 494,498 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-Hydroxy-2,3,3-triphenyl-propionsaeure-aethylester |
| 2-hydroxy-2,3,3-triphenyl-propionic acid ethyl ester |