2-methyl-1-phenyl-1,1-bis(phenylmethoxy)propan-2-ol structure
|
Common Name | 2-methyl-1-phenyl-1,1-bis(phenylmethoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 7476-45-1 | Molecular Weight | 362.46100 | |
| Density | 1.129g/cm3 | Boiling Point | 498.3ºC at 760 mmHg | |
| Molecular Formula | C24H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.2ºC | |
| Name | 2-methyl-1-phenyl-1,1-bis(phenylmethoxy)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 498.3ºC at 760 mmHg |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.46100 |
| Flash Point | 255.2ºC |
| Exact Mass | 362.18800 |
| PSA | 38.69000 |
| LogP | 5.04390 |
| Index of Refraction | 1.587 |
| InChIKey | SSFTXNVQKZVSHA-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(OCc1ccccc1)(OCc1ccccc1)c1ccccc1 |
|
~%
2-methyl-1-phen... CAS#:7476-45-1 |
| Literature: Stevens et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 2276,2278 |
|
~%
2-methyl-1-phen... CAS#:7476-45-1 |
| Literature: Stevens et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 2276,2278 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-hydroxy-2-methyl-1-phenyl-propan-1-one-dibenzylacetal |
| 2-Hydroxy-2-methyl-1-phenyl-propan-1-on-dibenzylacetal |