Acetamide,N-[4-(1-phenylethyl)phenyl]- structure
|
Common Name | Acetamide,N-[4-(1-phenylethyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 7476-72-4 | Molecular Weight | 239.31200 | |
| Density | 1.091g/cm3 | Boiling Point | 417ºC at 760mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.7ºC | |
| Name | N-[4-(1-phenylethyl)phenyl]acetamide |
|---|
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 252.7ºC |
| Exact Mass | 239.13100 |
| PSA | 29.10000 |
| LogP | 3.86980 |
| Index of Refraction | 1.595 |
| InChIKey | MMBXQTQBZPDCPT-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(C)c2ccccc2)cc1 |
|
~%
Acetamide,N-[4-... CAS#:7476-72-4 |
| Literature: Hickinbottom Journal of the Chemical Society, 1934 , p. 319,322 |
|
~%
Acetamide,N-[4-... CAS#:7476-72-4 |
| Literature: Hickinbottom Journal of the Chemical Society, 1934 , p. 319,322 |
|
~%
Acetamide,N-[4-... CAS#:7476-72-4 |
| Literature: Hickinbottom Journal of the Chemical Society, 1934 , p. 319,322 |
|
~%
Acetamide,N-[4-... CAS#:7476-72-4 |
| Literature: Hickinbottom Journal of the Chemical Society, 1934 , p. 319,322 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |