(6-methoxy-2-methylquinolin-4-yl) 2-[(4-chlorophenyl)methylideneamino]benzoate structure
|
Common Name | (6-methoxy-2-methylquinolin-4-yl) 2-[(4-chlorophenyl)methylideneamino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 74767-07-0 | Molecular Weight | 430.88300 | |
| Density | 1.23g/cm3 | Boiling Point | 619.8ºC at 760 mmHg | |
| Molecular Formula | C25H19ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.6ºC | |
| Name | (6-methoxy-2-methylquinolin-4-yl) 2-[(4-chlorophenyl)methylideneamino]benzoate |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 619.8ºC at 760 mmHg |
| Molecular Formula | C25H19ClN2O3 |
| Molecular Weight | 430.88300 |
| Flash Point | 328.6ºC |
| Exact Mass | 430.10800 |
| PSA | 60.78000 |
| LogP | 6.17500 |
| Index of Refraction | 1.615 |
| InChIKey | UOYVZTBBHODPFA-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(C)cc(OC(=O)c3ccccc3N=Cc3ccc(Cl)cc3)c2c1 |
|
~%
(6-methoxy-2-me... CAS#:74767-07-0 |
| Literature: Shukla, J. S.; Rastogi, Renu; Saxena, Shradha Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 1 p. 84 - 85 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |