(2,6-dimethylquinolin-4-yl) 2-[(4-oxocyclohexa-2,5-dien-1-ylidene)methylamino]benzoate structure
|
Common Name | (2,6-dimethylquinolin-4-yl) 2-[(4-oxocyclohexa-2,5-dien-1-ylidene)methylamino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 74767-09-2 | Molecular Weight | 396.43800 | |
| Density | 1.333g/cm3 | Boiling Point | 592.5ºC at 760 mmHg | |
| Molecular Formula | C25H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.1ºC | |
| Name | (2,6-dimethylquinolin-4-yl) 2-[(4-oxocyclohexa-2,5-dien-1-ylidene)methylamino]benzoate |
|---|
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 592.5ºC at 760 mmHg |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.43800 |
| Flash Point | 312.1ºC |
| Exact Mass | 396.14700 |
| PSA | 68.29000 |
| LogP | 5.13470 |
| Index of Refraction | 1.737 |
| InChIKey | NVXZNWACUJEJNX-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(C)cc(OC(=O)c3ccccc3N=Cc3ccc(O)cc3)c2c1 |
|
~%
(2,6-dimethylqu... CAS#:74767-09-2 |
| Literature: Shukla, J. S.; Rastogi, Renu; Saxena, Shradha Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 1 p. 84 - 85 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |