(6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate
![(6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate Structure](https://image.chemsrc.com/caspic/493/74767-17-2.png)
(6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate structure
|
Common Name | (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 74767-17-2 | Molecular Weight | 439.50600 | |
| Density | 1.15g/cm3 | Boiling Point | 642.5ºC at 760 mmHg | |
| Molecular Formula | C27H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 642.5ºC at 760 mmHg |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.50600 |
| Flash Point | 342.4ºC |
| Exact Mass | 439.19000 |
| PSA | 64.02000 |
| LogP | 5.58760 |
| Index of Refraction | 1.598 |
| InChIKey | RSRFASGHSVLYDW-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(C)cc(OC(=O)c3ccccc3N=Cc3ccc(N(C)C)cc3)c2c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(6-methoxy-2-me... CAS#:74767-17-2 |
| Literature: Shukla, J. S.; Rastogi, Renu; Saxena, Shradha Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 1 p. 84 - 85 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: Boiling point of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate is 642.5ºC at 760 mmHg. |
| Q: What is the English name of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: The English name of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate is (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate. |
| Q: What is the molecular formula of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: Molecular formula of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate is C27H25N3O3. |
| Q: What is the CAS number of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: CAS number of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate is 74767-17-2. |
| Q: What is the polar surface area (PSA) of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: Polar surface area (PSA) of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate is 64.02000. |
| Q: What is the Chinese name of 74767-17-2? |
| A: Chinese name of 74767-17-2 is 74767-17-2. |
| Q: What is the molecular weight of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: Molecular weight of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate is 439.50600. |
| Q: What is the LogP of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: LogP of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate is 5.58760. |
| Q: What is the InChIKey of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: InChIKey of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate is RSRFASGHSVLYDW-UHFFFAOYSA-N. |
| Q: What are the upstream materials of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate? |
| A: Related upstream materials(CAS) of (6-methoxy-2-methylquinolin-4-yl) 2-[[4-(dimethylamino)phenyl]methylideneamino]benzoate: 15644-90-3;77810-69-6. |