[2-(4-chlorobenzoyl)phenyl]-(4-chlorophenyl)methanone structure
|
Common Name | [2-(4-chlorobenzoyl)phenyl]-(4-chlorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 7477-14-7 | Molecular Weight | 355.21400 | |
| Density | 1.317g/cm3 | Boiling Point | 539ºC at 760 mmHg | |
| Molecular Formula | C20H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.4ºC | |
| Name | [2-(4-chlorobenzoyl)phenyl]-(4-chlorophenyl)methanone |
|---|
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 539ºC at 760 mmHg |
| Molecular Formula | C20H12Cl2O2 |
| Molecular Weight | 355.21400 |
| Flash Point | 224.4ºC |
| Exact Mass | 354.02100 |
| PSA | 34.14000 |
| LogP | 5.45540 |
| Index of Refraction | 1.627 |
| InChIKey | VXIRFFIPWDAJRD-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccccc1C(=O)c1ccc(Cl)cc1 |
|
~%
[2-(4-chloroben... CAS#:7477-14-7 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1936 , vol. 58, p. 273,274 |
|
~%
[2-(4-chloroben... CAS#:7477-14-7 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1936 , vol. 58, p. 273,274 |
|
~%
[2-(4-chloroben... CAS#:7477-14-7 |
| Literature: Adams; Wearn Journal of the American Chemical Society, 1940 , vol. 62, p. 1233,1235 |