9(10H)-Anthracenone,2-(acetyloxy)-10-[4-(acetyloxy)phenyl]-10-hydroxy- structure
|
Common Name | 9(10H)-Anthracenone,2-(acetyloxy)-10-[4-(acetyloxy)phenyl]-10-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 7477-37-4 | Molecular Weight | 402.39600 | |
| Density | 1.352g/cm3 | Boiling Point | 591.1ºC at 760 mmHg | |
| Molecular Formula | C24H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.2ºC | |
| Name | [4-(3-acetyloxy-9-hydroxy-10-oxoanthracen-9-yl)phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 591.1ºC at 760 mmHg |
| Molecular Formula | C24H18O6 |
| Molecular Weight | 402.39600 |
| Flash Point | 206.2ºC |
| Exact Mass | 402.11000 |
| PSA | 89.90000 |
| LogP | 3.36580 |
| Index of Refraction | 1.64 |
| InChIKey | MVZDZPPTJDBNGW-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(C2(O)c3ccccc3C(=O)c3cc(OC(C)=O)ccc32)cc1 |
|
~%
9(10H)-Anthrace... CAS#:7477-37-4 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1938 , vol. 60, p. 2642 |
|
~%
9(10H)-Anthrace... CAS#:7477-37-4 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1938 , vol. 60, p. 2642 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-acetoxy-10-(4-acetoxy-phenyl)-10-hydroxy-anthrone |