2-(quinoline-2-carbonylamino)hexanoic acid
2-(quinoline-2-carbonylamino)hexanoic acid structure
|
Common Name | 2-(quinoline-2-carbonylamino)hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7477-48-7 | Molecular Weight | 286.32600 | |
| Density | 1.22g/cm3 | Boiling Point | 565.3ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(quinoline-2-carbonylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 565.3ºC at 760 mmHg |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.32600 |
| Flash Point | 295.7ºC |
| Exact Mass | 286.13200 |
| PSA | 79.29000 |
| LogP | 2.99890 |
| Index of Refraction | 1.602 |
| InChIKey | JQMQDTQKMDHKQA-UHFFFAOYSA-N |
| SMILES | CCCCC(NC(=O)c1ccc2ccccc2n1)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(quinoline-2-... CAS#:7477-48-7 |
| Literature: Davis Journal of Organic Chemistry, 1959 , vol. 24, p. 1691,1693, 1694 |
|
~%
2-(quinoline-2-... CAS#:7477-48-7 |
| Literature: O'Donnell, Martin J.; Delgado, Francisca; Drew, Mark D.; Pottorf, Richard S.; Zhou, Changyou; Scott, William L. Tetrahedron Letters, 1999 , vol. 40, # 32 p. 5831 - 5835 |
![9-butyl-9-borabicyclo[3.3.1]nonane structure](https://image.chemsrc.com/caspic/377/23532-74-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(quinoline-2-carbonyl)-DL-norleucine |
| N-(Chinolin-2-carbonyl)-DL-norleucin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: The English name of 2-(quinoline-2-carbonylamino)hexanoic acid is 2-(quinoline-2-carbonylamino)hexanoic acid. |
| Q: What is the polar surface area (PSA) of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: Polar surface area (PSA) of 2-(quinoline-2-carbonylamino)hexanoic acid is 79.29000. |
| Q: What is the molecular formula of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: Molecular formula of 2-(quinoline-2-carbonylamino)hexanoic acid is C16H18N2O3. |
| Q: What are the upstream materials of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: Related upstream materials(CAS) of 2-(quinoline-2-carbonylamino)hexanoic acid: 50342-01-3;616-06-8;23532-74-3;93-10-7. |
| Q: What is the boiling point of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: Boiling point of 2-(quinoline-2-carbonylamino)hexanoic acid is 565.3ºC at 760 mmHg. |
| Q: What is the LogP of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: LogP of 2-(quinoline-2-carbonylamino)hexanoic acid is 2.99890. |
| Q: What is the molecular weight of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: Molecular weight of 2-(quinoline-2-carbonylamino)hexanoic acid is 286.32600. |
| Q: What is the SMILES notation of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: SMILES notation of 2-(quinoline-2-carbonylamino)hexanoic acid is CCCCC(NC(=O)c1ccc2ccccc2n1)C(=O)O. |
| Q: What English synonyms does 2-(quinoline-2-carbonylamino)hexanoic acid have? |
| A: English synonyms of 2-(quinoline-2-carbonylamino)hexanoic acid: N-(quinoline-2-carbonyl)-DL-norleucine, N-(Chinolin-2-carbonyl)-DL-norleucin. |
| Q: What is the InChIKey of 2-(quinoline-2-carbonylamino)hexanoic acid? |
| A: InChIKey of 2-(quinoline-2-carbonylamino)hexanoic acid is JQMQDTQKMDHKQA-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |