4-methylnaphthalene-1,2-dione
4-methylnaphthalene-1,2-dione structure
|
Common Name | 4-methylnaphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 7477-57-8 | Molecular Weight | 172.18000 | |
| Density | 1.225g/cm3 | Boiling Point | 302.8ºC at 760 mmHg | |
| Molecular Formula | C11H8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methylnaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 302.8ºC at 760 mmHg |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18000 |
| Flash Point | 120.7ºC |
| Exact Mass | 172.05200 |
| PSA | 34.14000 |
| LogP | 1.85530 |
| Index of Refraction | 1.592 |
| InChIKey | CQOLMXXJPNVCME-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=O)c2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![(3,4-dioxo-3,4-dihydro-[1]naphthyl)-malonic acid diethyl ester structure](https://image.chemsrc.com/caspic/029/18093-47-5.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 1 | |
CAS#:21720-68-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Methyl-1,2-naphthochinon |
| 4-methyl-1,2-naphthalenedione |
| 4-Methyl-naphthochinon-(1,2) |
| 4-methyl-naphthalene-1,2-dione |
| 4-methyl-1,2-naphthoquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 7477-57-8? |
| A: Chinese name of 7477-57-8 is 7477-57-8. |
| Q: What is the molecular formula of 4-methylnaphthalene-1,2-dione? |
| A: Molecular formula of 4-methylnaphthalene-1,2-dione is C11H8O2. |
| Q: What is the English name of 4-methylnaphthalene-1,2-dione? |
| A: The English name of 4-methylnaphthalene-1,2-dione is 4-methylnaphthalene-1,2-dione. |
| Q: What is the LogP of 4-methylnaphthalene-1,2-dione? |
| A: LogP of 4-methylnaphthalene-1,2-dione is 1.85530. |
| Q: What is the SMILES notation of 4-methylnaphthalene-1,2-dione? |
| A: SMILES notation of 4-methylnaphthalene-1,2-dione is CC1=CC(=O)C(=O)c2ccccc21. |
| Q: What is the molecular weight of 4-methylnaphthalene-1,2-dione? |
| A: Molecular weight of 4-methylnaphthalene-1,2-dione is 172.18000. |
| Q: What is the InChIKey of 4-methylnaphthalene-1,2-dione? |
| A: InChIKey of 4-methylnaphthalene-1,2-dione is CQOLMXXJPNVCME-UHFFFAOYSA-N. |
| Q: What are the downstream products of 4-methylnaphthalene-1,2-dione? |
| A: Related downstream products(CAS) of 4-methylnaphthalene-1,2-dione: 21720-68-3. |
| Q: What is the boiling point of 4-methylnaphthalene-1,2-dione? |
| A: Boiling point of 4-methylnaphthalene-1,2-dione is 302.8ºC at 760 mmHg. |
| Q: What English synonyms does 4-methylnaphthalene-1,2-dione have? |
| A: English synonyms of 4-methylnaphthalene-1,2-dione: 4-Methyl-1,2-naphthochinon, 4-methyl-1,2-naphthalenedione, 4-Methyl-naphthochinon-(1,2), 4-methyl-naphthalene-1,2-dione, 4-methyl-1,2-naphthoquinone. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |