Ethanone,1-(4-chlorophenyl)-2-(3,4-dihydro-1(2H)-quinolinyl)- structure
|
Common Name | Ethanone,1-(4-chlorophenyl)-2-(3,4-dihydro-1(2H)-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 7477-80-7 | Molecular Weight | 285.76800 | |
| Density | 1.209g/cm3 | Boiling Point | 468.1ºC at 760 mmHg | |
| Molecular Formula | C17H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.9ºC | |
| Name | 1-(4-chlorophenyl)-2-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 468.1ºC at 760 mmHg |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.76800 |
| Flash Point | 236.9ºC |
| Exact Mass | 285.09200 |
| PSA | 20.31000 |
| LogP | 4.04050 |
| Index of Refraction | 1.603 |
| InChIKey | NJKMKSJWEQLMGQ-UHFFFAOYSA-N |
| SMILES | O=C(CN1CCCc2ccccc21)c1ccc(Cl)cc1 |
| HS Code | 2933499090 |
|---|
|
~73%
Ethanone,1-(4-c... CAS#:7477-80-7 |
| Literature: Ganguly, Swastika; Murugesan Journal of the Indian Chemical Society, 2010 , vol. 87, # 7 p. 879 - 885 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |