Ethanone,2-(3,4-dihydro-1(2H)-quinolinyl)-1-(3-nitrophenyl)-
Modify Date: 2025-08-27 14:29:38
Ethanone,2-(3,4-dihydro-1(2H)-quinolinyl)-1-(3-nitrophenyl)- structure
|
Common Name | Ethanone,2-(3,4-dihydro-1(2H)-quinolinyl)-1-(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7477-81-8 | Molecular Weight | 296.32100 | |
| Density | 1.254g/cm3 | Boiling Point | 466.4ºC at 760mmHg | |
| Molecular Formula | C17H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
| Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-nitrophenyl)ethanone |
|---|
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760mmHg |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.32100 |
| Flash Point | 235.8ºC |
| Exact Mass | 296.11600 |
| PSA | 66.13000 |
| LogP | 3.81850 |
| Index of Refraction | 1.618 |
| InChIKey | KLRCJHRJALWQRV-UHFFFAOYSA-N |
| SMILES | O=C(CN1CCCc2ccccc21)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2933499090 |
|---|
|
~%
Ethanone,2-(3,4... CAS#:7477-81-8 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4198 |
|
~%
Ethanone,2-(3,4... CAS#:7477-81-8 |
| Literature: Kunckell Chemische Berichte, 1897 , vol. 30, p. 576 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |