(NZ)-N-(1-phenyl-2-pyridin-1-yl-ethylidene)hydroxylamine structure
|
Common Name | (NZ)-N-(1-phenyl-2-pyridin-1-yl-ethylidene)hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 7478-05-9 | Molecular Weight | 340.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13IN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (NE)-N-(1-phenyl-2-pyridin-1-ium-1-ylethylidene)hydroxylamine,iodide |
|---|
| Molecular Formula | C13H13IN2O |
|---|---|
| Molecular Weight | 340.16000 |
| Exact Mass | 340.00700 |
| PSA | 36.47000 |
| InChIKey | WXNIYFUNOMIPLX-HPWRNOGASA-N |
| SMILES | ON=C(C[n+]1ccccc1)c1ccccc1.[I-] |
|
~%
(NZ)-N-(1-pheny... CAS#:7478-05-9 |
| Literature: Hartwell; Kornberg Journal of the American Chemical Society, 1946 , vol. 68, p. 868 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |