Pyridinium, 1-[2-(2-hydroxy-5-methylphenyl)-2-oxoethyl]-,iodide (1:1) structure
|
Common Name | Pyridinium, 1-[2-(2-hydroxy-5-methylphenyl)-2-oxoethyl]-,iodide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 7478-08-2 | Molecular Weight | 355.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxy-5-methylphenyl)-2-pyridin-1-ium-1-ylethanone,iodide |
|---|
| Molecular Formula | C14H14INO2 |
|---|---|
| Molecular Weight | 355.17100 |
| Exact Mass | 355.00700 |
| PSA | 41.18000 |
| InChIKey | CBRSUNOLVUBPLJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(C(=O)C[n+]2ccccc2)c1.[I-] |
|
~%
Pyridinium, 1-[... CAS#:7478-08-2 |
| Literature: King; McWhirter; Barton Journal of the American Chemical Society, 1945 , vol. 67, p. 2089,2090 |
|
~%
Pyridinium, 1-[... CAS#:7478-08-2 |
| Literature: King; McWhirter; Barton Journal of the American Chemical Society, 1945 , vol. 67, p. 2089,2090 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |