2-[5-(2-hydroxyethyl)-4-methyl-1-thia-3-azoniacyclopenta-2,4-dien-3-yl]-1-phenyl-ethanone structure
|
Common Name | 2-[5-(2-hydroxyethyl)-4-methyl-1-thia-3-azoniacyclopenta-2,4-dien-3-yl]-1-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 7478-09-3 | Molecular Weight | 342.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium-3-yl]-1-phenylethanone,bromide |
|---|
| Molecular Formula | C14H16BrNO2S |
|---|---|
| Molecular Weight | 342.25100 |
| Exact Mass | 341.00900 |
| PSA | 69.42000 |
| InChIKey | JFRQWQPHEDJRMV-UHFFFAOYSA-M |
| SMILES | Cc1c(CCO)sc[n+]1CC(=O)c1ccccc1.[Br-] |
|
~%
2-[5-(2-hydroxy... CAS#:7478-09-3 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 1652 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |