(NZ)-N-[1-(4-bromophenyl)-2-(2-ethyl-4-methyl-1-thia-3-azoniacyclopenta-2,4-dien-3-yl)ethylidene]hydroxylamine structure
|
Common Name | (NZ)-N-[1-(4-bromophenyl)-2-(2-ethyl-4-methyl-1-thia-3-azoniacyclopenta-2,4-dien-3-yl)ethylidene]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 7478-40-2 | Molecular Weight | 420.16300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16Br2N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (NE)-N-[1-(4-bromophenyl)-2-(2-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)ethylidene]hydroxylamine,bromide |
|---|
| Molecular Formula | C14H16Br2N2OS |
|---|---|
| Molecular Weight | 420.16300 |
| Exact Mass | 417.93500 |
| PSA | 64.71000 |
| LogP | 0.55140 |
| InChIKey | GBHDJYPCCTYLGX-UNVLYCKESA-N |
| SMILES | CCc1scc(C)[n+]1CC(=NO)c1ccc(Br)cc1.[Br-] |
|
~%
(NZ)-N-[1-(4-br... CAS#:7478-40-2 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 1652 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |