3-(3-hydroxy-1-phenyl-prop-1-en-2-yl)-1H-quinoxalin-2-one structure
|
Common Name | 3-(3-hydroxy-1-phenyl-prop-1-en-2-yl)-1H-quinoxalin-2-one | ||
|---|---|---|---|---|
| CAS Number | 7478-53-7 | Molecular Weight | 278.30500 | |
| Density | 1.23g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(Z)-3-hydroxy-1-phenylprop-1-en-2-yl]-1H-quinoxalin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.30500 |
| Exact Mass | 278.10600 |
| PSA | 65.98000 |
| LogP | 2.45600 |
| Index of Refraction | 1.64 |
| InChIKey | BVLRUECDCCKEGA-JLHYYAGUSA-N |
| SMILES | O=c1[nH]c2ccccc2nc1C(=Cc1ccccc1)CO |
|
~%
3-(3-hydroxy-1-... CAS#:7478-53-7 |
| Literature: Zimmer, Hans; Manning, M. J.; Ventura, M.; Amer, Adel; Massry, Abdel Monem El Journal of Heterocyclic Chemistry, 1986 , vol. 23, p. 199 - 202 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-<E-(1'-hydroxymethyl-2'-phenyl)ethenyl>-2(1H)-quinoxalinone |