methyl 2-amino-3-(4-methoxyphenyl)propanoate structure
|
Common Name | methyl 2-amino-3-(4-methoxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 7479-01-8 | Molecular Weight | 245.70300 | |
| Density | 1.12g/cm3 | Boiling Point | 309ºC at 760 mmHg | |
| Molecular Formula | C11H16ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.5ºC | |
| Name | methyl 2-amino-3-(4-methoxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 309ºC at 760 mmHg |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.70300 |
| Flash Point | 127.5ºC |
| Exact Mass | 245.08200 |
| PSA | 61.55000 |
| LogP | 2.24030 |
| Index of Refraction | 1.522 |
| InChIKey | CDCIQNBPLQWUQS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)Cc1ccc(OC)cc1.Cl |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| (S)-O-methyltyrosine methyl ester hydrochloride |
| methyl (2R)-2-amino-3-(4-methoxyphenyl)propanoate |
| 3-(p-methoxyphenyl)-L-alanine methyl ester hydrochloride |
| I01-8547 |
| hydrochloride salt of 0-methyltyrosine methyl ester |
| O-Methyl-L-tyrosin-methylester,Hydrochlorid |
| L-(O-methyl)tyrosine methyl ester hydrochloride |
| O-methyl-L-tyrosine methyl ester hydrochloride |