1H-Indole,3,3'-[2-(2-nitrophenyl)ethylidene]bis- structure
|
Common Name | 1H-Indole,3,3'-[2-(2-nitrophenyl)ethylidene]bis- | ||
|---|---|---|---|---|
| CAS Number | 7479-22-3 | Molecular Weight | 381.42700 | |
| Density | 1.345g/cm3 | Boiling Point | 594.9ºC at 760 mmHg | |
| Molecular Formula | C24H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.6ºC | |
| Name | 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 594.9ºC at 760 mmHg |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.42700 |
| Flash Point | 313.6ºC |
| Exact Mass | 381.14800 |
| PSA | 77.40000 |
| LogP | 6.45520 |
| Index of Refraction | 1.752 |
| InChIKey | ILMUODPKCQIMHQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CC(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
|
~%
1H-Indole,3,3'-... CAS#:7479-22-3 |
| Literature: Ishii, Hisashi; Murakami, Keiko; Sakurada(nee Kawanabe), Eri; Hosoya, Katsuhiro; Murakami, Yasuoki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2377 - 2386 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 3,3'-<2-(2-Nitro-phenyl)-ethyliden>-bis-indol |
| 1H,1'H-3,3'-[2-(2-nitro-phenyl)-ethane-1,1-diyl]-bis-indole |
| 3,3'-(o-nitrophenethylidene)di-indole |