1H-Indole,3,3'-[2-(2-nitrophenyl)ethylidene]bis
![1H-Indole,3,3'-[2-(2-nitrophenyl)ethylidene]bis Structure](https://image.chemsrc.com/caspic/048/7479-22-3.png)
1H-Indole,3,3'-[2-(2-nitrophenyl)ethylidene]bis structure
|
Common Name | 1H-Indole,3,3'-[2-(2-nitrophenyl)ethylidene]bis | ||
|---|---|---|---|---|
| CAS Number | 7479-22-3 | Molecular Weight | 381.42700 | |
| Density | 1.345g/cm3 | Boiling Point | 594.9ºC at 760 mmHg | |
| Molecular Formula | C24H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 594.9ºC at 760 mmHg |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.42700 |
| Flash Point | 313.6ºC |
| Exact Mass | 381.14800 |
| PSA | 77.40000 |
| LogP | 6.45520 |
| Index of Refraction | 1.752 |
| InChIKey | ILMUODPKCQIMHQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CC(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1H-Indole,3,3'-... CAS#:7479-22-3 |
| Literature: Ishii, Hisashi; Murakami, Keiko; Sakurada(nee Kawanabe), Eri; Hosoya, Katsuhiro; Murakami, Yasuoki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2377 - 2386 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
![N-[2-[2,2-bis(1H-indol-3-yl)ethyl]phenyl]acetamide structure](https://image.chemsrc.com/caspic/108/6548-01-2.png)
CAS#:6548-01-2
CAS#:6941-73-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3'-<2-(2-Nitro-phenyl)-ethyliden>-bis-indol |
| 1H,1'H-3,3'-[2-(2-nitro-phenyl)-ethane-1,1-diyl]-bis-indole |
| 3,3'-(o-nitrophenethylidene)di-indole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole have? |
| A: English synonyms of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole: 3,3'--bis-indol, 1H,1'H-3,3'-[2-(2-nitro-phenyl)-ethane-1,1-diyl]-bis-indole, 3,3'-(o-nitrophenethylidene)di-indole. |
| Q: What is the molecular formula of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: Molecular formula of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole is C24H19N3O2. |
| Q: What is the polar surface area (PSA) of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: Polar surface area (PSA) of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole is 77.40000. |
| Q: What is the InChIKey of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: InChIKey of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole is ILMUODPKCQIMHQ-UHFFFAOYSA-N. |
| Q: What is the English name of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: The English name of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole is 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole. |
| Q: What is the LogP of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: LogP of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole is 6.45520. |
| Q: What is the SMILES notation of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: SMILES notation of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole is O=[N+]([O-])c1ccccc1CC(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12. |
| Q: What are the downstream products of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: Related downstream products(CAS) of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole: 6548-01-2;6941-73-7. |
| Q: What is the CAS number of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: CAS number of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole is 7479-22-3. |
| Q: What is the boiling point of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole? |
| A: Boiling point of 3-[1-(1H-indol-3-yl)-2-(2-nitrophenyl)ethyl]-1H-indole is 594.9ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |