2-(1H-benzimidazol-2-ylmethylsulfanyl)-5-(4-chlorophenyl)-1,3,4-oxadiazole structure
|
Common Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-5-(4-chlorophenyl)-1,3,4-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 74827-76-2 | Molecular Weight | 342.80300 | |
| Density | 1.52g/cm3 | Boiling Point | 599.7ºC at 760 mmHg | |
| Molecular Formula | C16H11ClN4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.5ºC | |
| Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-5-(4-chlorophenyl)-1,3,4-oxadiazole |
|---|
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 599.7ºC at 760 mmHg |
| Molecular Formula | C16H11ClN4OS |
| Molecular Weight | 342.80300 |
| Flash Point | 316.5ºC |
| Exact Mass | 342.03400 |
| PSA | 92.90000 |
| LogP | 4.55860 |
| Index of Refraction | 1.741 |
| InChIKey | YCRGARSSCGVMSS-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2nnc(SCc3nc4ccccc4[nH]3)o2)cc1 |
|
~%
2-(1H-benzimida... CAS#:74827-76-2 |
| Literature: Mishra; Singh; Dubey Bioscience, biotechnology, and biochemistry, 1993 , vol. 57, # 6 p. 989 - 991 |
|
~%
2-(1H-benzimida... CAS#:74827-76-2 |
| Literature: Mishra; Singh; Dubey Bioscience, biotechnology, and biochemistry, 1993 , vol. 57, # 6 p. 989 - 991 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |