methyl 2-(benzenesulfonyl)-3,3-dimethylpent-4-enoate structure
|
Common Name | methyl 2-(benzenesulfonyl)-3,3-dimethylpent-4-enoate | ||
|---|---|---|---|---|
| CAS Number | 74866-36-7 | Molecular Weight | 282.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(benzenesulfonyl)-3,3-dimethylpent-4-enoate |
|---|
| Molecular Formula | C14H18O4S |
|---|---|
| Molecular Weight | 282.35500 |
| Exact Mass | 282.09300 |
| PSA | 68.82000 |
| LogP | 3.29490 |
| InChIKey | YINFMSMVBWJDDZ-UHFFFAOYSA-N |
| SMILES | C=CC(C)(C)C(C(=O)OC)S(=O)(=O)c1ccccc1 |
|
~%
methyl 2-(benze... CAS#:74866-36-7 |
| Literature: Trost, Barry M.; Schmuff, Norman R.; Miller, Michael J. Journal of the American Chemical Society, 1980 , vol. 102, # 18 p. 5979 - 5981 |
|
~%
methyl 2-(benze... CAS#:74866-36-7 |
| Literature: Plietker, Bernd Patent: US2007/49770 A1, 2007 ; Location in patent: Page/Page column 3; Sheet 3 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |