Ketocainol structure
|
Common Name | Ketocainol | ||
|---|---|---|---|---|
| CAS Number | 7488-92-8 | Molecular Weight | 293.44400 | |
| Density | 0.977g/cm3 | Boiling Point | 354.4ºC at 760 mmHg | |
| Molecular Formula | C18H31NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.1ºC | |
| Name | Ketocainol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.977g/cm3 |
|---|---|
| Boiling Point | 354.4ºC at 760 mmHg |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.44400 |
| Flash Point | 168.1ºC |
| Exact Mass | 293.23500 |
| PSA | 32.70000 |
| LogP | 4.01770 |
| Index of Refraction | 1.502 |
| InChIKey | DBQHPYODCJJUAP-UHFFFAOYSA-N |
| SMILES | CCCC(O)c1ccccc1OCCN(C(C)C)C(C)C |
|
~%
Ketocainol CAS#:7488-92-8 |
| Literature: Da Re,P. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 266 - 270 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-(N-Diisopropylamino-aethoxyphenyl)-butan-1-ol |
| 1-(2-Diisopropylamino-ethoxy)-2-(1-hydroxy-butyl)-benzol |
| Rec-7-0544 |