bis[(2-methylpropan-2-yl)oxy]methylsilane
![bis[(2-methylpropan-2-yl)oxy]methylsilane Structure](https://image.chemsrc.com/caspic/112/7489-74-9.png)
bis[(2-methylpropan-2-yl)oxy]methylsilane structure
|
Common Name | bis[(2-methylpropan-2-yl)oxy]methylsilane | ||
|---|---|---|---|---|
| CAS Number | 7489-74-9 | Molecular Weight | 190.35500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H22O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis[(2-methylpropan-2-yl)oxy]methylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H22O2Si |
|---|---|
| Molecular Weight | 190.35500 |
| Exact Mass | 190.13900 |
| PSA | 18.46000 |
| LogP | 1.68550 |
| InChIKey | HWTBJHKDIBEWFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC([Si])OC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bis[(2-methylpr... CAS#:7489-74-9 |
| Literature: Hetflejs,J. et al. Collection of Czechoslovak Chemical Communications, 1966 , vol. 31, p. 586 - 601 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methyl-bis-tert.-butyloxy-silan |
| Di-tert.-butoxymethylsilan |
| methyldi-t-butoxysilane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of bis[(2-methylpropan-2-yl)oxy]methylsilane? |
| A: Related upstream materials(CAS) of bis[(2-methylpropan-2-yl)oxy]methylsilane: 75-54-7;75-65-0. |
| Q: What is the LogP of bis[(2-methylpropan-2-yl)oxy]methylsilane? |
| A: LogP of bis[(2-methylpropan-2-yl)oxy]methylsilane is 1.68550. |
| Q: What is the SMILES notation of bis[(2-methylpropan-2-yl)oxy]methylsilane? |
| A: SMILES notation of bis[(2-methylpropan-2-yl)oxy]methylsilane is CC(C)(C)OC([Si])OC(C)(C)C. |
| Q: What is the InChIKey of bis[(2-methylpropan-2-yl)oxy]methylsilane? |
| A: InChIKey of bis[(2-methylpropan-2-yl)oxy]methylsilane is HWTBJHKDIBEWFB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 7489-74-9? |
| A: Chinese name of 7489-74-9 is 7489-74-9. |
| Q: What English synonyms does bis[(2-methylpropan-2-yl)oxy]methylsilane have? |
| A: English synonyms of bis[(2-methylpropan-2-yl)oxy]methylsilane: Methyl-bis-tert.-butyloxy-silan, Di-tert.-butoxymethylsilan, methyldi-t-butoxysilane. |
| Q: What is the polar surface area (PSA) of bis[(2-methylpropan-2-yl)oxy]methylsilane? |
| A: Polar surface area (PSA) of bis[(2-methylpropan-2-yl)oxy]methylsilane is 18.46000. |
| Q: What is the molecular weight of bis[(2-methylpropan-2-yl)oxy]methylsilane? |
| A: Molecular weight of bis[(2-methylpropan-2-yl)oxy]methylsilane is 190.35500. |
| Q: What is the English name of bis[(2-methylpropan-2-yl)oxy]methylsilane? |
| A: The English name of bis[(2-methylpropan-2-yl)oxy]methylsilane is bis[(2-methylpropan-2-yl)oxy]methylsilane. |
| Q: What is the CAS number of bis[(2-methylpropan-2-yl)oxy]methylsilane? |
| A: CAS number of bis[(2-methylpropan-2-yl)oxy]methylsilane is 7489-74-9. |