alpha-bromo-4-amino-3-nitroacetophenone structure
|
Common Name | alpha-bromo-4-amino-3-nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 74902-59-3 | Molecular Weight | 259.05700 | |
| Density | 1.747g/cm3 | Boiling Point | 383ºC at 760 mmHg | |
| Molecular Formula | C8H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.4ºC | |
| Name | 1-(4-amino-3-nitrophenyl)-2-bromoethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.747g/cm3 |
|---|---|
| Boiling Point | 383ºC at 760 mmHg |
| Molecular Formula | C8H7BrN2O3 |
| Molecular Weight | 259.05700 |
| Flash Point | 185.4ºC |
| Exact Mass | 257.96400 |
| PSA | 88.91000 |
| LogP | 2.85900 |
| Index of Refraction | 1.66 |
| InChIKey | LCFRGYUASANOFK-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)CBr)cc1[N+](=O)[O-] |
| HS Code | 2922399090 |
|---|
|
~69%
alpha-bromo-4-a... CAS#:74902-59-3 |
| Literature: Iradyan, M. A.; Aroyan, R. A.; Engoyan, A. P.; Pogosyan, A. V.; Stepanyan, G. M.; et al. Pharmaceutical Chemistry Journal, 1990 , vol. 24, # 7 p. 481 - 485 Khimiko-Farmatsevticheskii Zhurnal, 1990 , vol. 24, # 7 p. 38 - 41 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| a-Bromo-4-amino-3-nitroacetophenone |
| Aba-nap |
| 4-amino-3-nitrophenacyl bromide |