2-[amino-(N-ethylanilino)methylidene]propanedinitrile structure
|
Common Name | 2-[amino-(N-ethylanilino)methylidene]propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 74905-01-4 | Molecular Weight | 212.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[amino-(N-ethylanilino)methylidene]propanedinitrile |
|---|
| Molecular Formula | C12H12N4 |
|---|---|
| Molecular Weight | 212.25000 |
| Exact Mass | 212.10600 |
| PSA | 76.84000 |
| LogP | 2.43066 |
| InChIKey | YELDYMMJJIIEQQ-UHFFFAOYSA-N |
| SMILES | CCN(C(N)=C(C#N)C#N)c1ccccc1 |
|
~58%
2-[amino-(N-eth... CAS#:74905-01-4 |
| Literature: Elvidge, John A.; Judson, Philip N.; Percival, Albert; Shah, Raksha Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1741 - 1744 |
|
~%
2-[amino-(N-eth... CAS#:74905-01-4 |
| Literature: Elvidge, John A.; Judson, Philip N.; Percival, Albert; Shah, Raksha Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1741 - 1744 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |