phenyl 3-amino-3-anilino-2-cyanoprop-2-enoate structure
|
Common Name | phenyl 3-amino-3-anilino-2-cyanoprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 74906-02-8 | Molecular Weight | 279.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl 3-amino-3-anilino-2-cyanoprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13N3O2 |
|---|---|
| Molecular Weight | 279.29300 |
| Exact Mass | 279.10100 |
| PSA | 88.14000 |
| LogP | 3.17128 |
| InChIKey | HOTQFRYPKJFKKC-UHFFFAOYSA-N |
| SMILES | N#CC(C(=O)Oc1ccccc1)=C(N)Nc1ccccc1 |
|
~%
phenyl 3-amino-... CAS#:74906-02-8 |
| Literature: Elvidge, John A.; Judson, Philip N.; Percival, Albert; Shah, Raksha Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1741 - 1744 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| phenyl 3-amino-2-cyano-3-phenylaminopropenoate |