3-anilino-2-cyano-3-(dimethylamino)prop-2-enamide structure
|
Common Name | 3-anilino-2-cyano-3-(dimethylamino)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 74906-88-0 | Molecular Weight | 230.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-anilino-2-cyano-3-(dimethylamino)prop-2-enamide |
|---|
| Molecular Formula | C12H14N4O |
|---|---|
| Molecular Weight | 230.26600 |
| Exact Mass | 230.11700 |
| PSA | 83.14000 |
| LogP | 2.10328 |
| InChIKey | SWCATGJAAXDTLG-UHFFFAOYSA-N |
| SMILES | CN(C)C(Nc1ccccc1)=C(C#N)C(N)=O |
|
~55%
3-anilino-2-cya... CAS#:74906-88-0 |
| Literature: Elvidge, John A.; Judson, Philip N.; Percival, Albert; Shah, Raksha Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1741 - 1744 |
|
~%
3-anilino-2-cya... CAS#:74906-88-0 |
| Literature: Elvidge, John A.; Judson, Philip N.; Percival, Albert; Shah, Raksha Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1741 - 1744 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |