2-pyridin-2-ylquinoline-4-carboxylic acid structure
|
Common Name | 2-pyridin-2-ylquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 7491-86-3 | Molecular Weight | 250.25200 | |
| Density | 1.332g/cm3 | Boiling Point | 472ºC at 760mmHg | |
| Molecular Formula | C15H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | 2-(2-Pyridinyl)-4-quinolinecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 472ºC at 760mmHg |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.25200 |
| Flash Point | 239.2ºC |
| Exact Mass | 250.07400 |
| PSA | 63.08000 |
| LogP | 2.99500 |
| InChIKey | WSYCFYURDIXHNT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccn2)nc2ccccc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: A screen for compounds that inhibit viral RNA polymerase binding and polymerization a...
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: Chain A, Poliovirus Polymerase With Gtp
External Id: HMS750
|
| 2-Picolinamidobenzoesaeure |
| N-Picolinoyl-anthranilsaeure |
| 2-Picolinoylaminobenzoesaeure |