5,7-dihydroxy-4-phenylisochromen-1-one structure
|
Common Name | 5,7-dihydroxy-4-phenylisochromen-1-one | ||
|---|---|---|---|---|
| CAS Number | 74919-06-5 | Molecular Weight | 254.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,7-dihydroxy-4-phenylisochromen-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10O4 |
|---|---|
| Molecular Weight | 254.23700 |
| Exact Mass | 254.05800 |
| PSA | 70.67000 |
| LogP | 2.87120 |
| InChIKey | ATULVSKGFTUYBY-UHFFFAOYSA-N |
| SMILES | O=c1occ(-c2ccccc2)c2c(O)cc(O)cc12 |
|
~%
5,7-dihydroxy-4... CAS#:74919-06-5 |
| Literature: Fritsch Patent: DE73700 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 970 |
|
~%
5,7-dihydroxy-4... CAS#:74919-06-5 |
| Literature: Sarkhel, B. K.; Srivastava, Jagdish N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 2 p. 158 - 159 |
|
~%
5,7-dihydroxy-4... CAS#:74919-06-5 |
| Literature: Sarkhel, B. K.; Srivastava, Jagdish N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 2 p. 158 - 159 |
|
~%
5,7-dihydroxy-4... CAS#:74919-06-5 |
| Literature: Fritsch Patent: DE73700 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 970 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5,7-Dihydroxy-4-phenyl-isocumarin |
| 5,7-dihydroxy-4-phenyl-isocoumarin |
| 1H-2-Benzopyran-1-one,5,7-dihydroxy-4-phenyl |