2,3,4-trichloro-9-methoxy-2,3-dihydrofuro[3,2-g]chromen-7-one structure
|
Common Name | 2,3,4-trichloro-9-methoxy-2,3-dihydrofuro[3,2-g]chromen-7-one | ||
|---|---|---|---|---|
| CAS Number | 7494-70-4 | Molecular Weight | 321.54100 | |
| Density | 1.66g/cm3 | Boiling Point | 454ºC at 760 mmHg | |
| Molecular Formula | C12H7Cl3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.5ºC | |
| Name | 2,3,4-trichloro-9-methoxy-2,3-dihydrofuro[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 454ºC at 760 mmHg |
| Molecular Formula | C12H7Cl3O4 |
| Molecular Weight | 321.54100 |
| Flash Point | 193.5ºC |
| Exact Mass | 319.94100 |
| PSA | 48.67000 |
| LogP | 3.69220 |
| Index of Refraction | 1.644 |
| InChIKey | MBJHFHOPUUGTQM-UHFFFAOYSA-N |
| SMILES | COc1c2c(c(Cl)c3ccc(=O)oc13)C(Cl)C(Cl)O2 |
|
~%
2,3,4-trichloro... CAS#:7494-70-4 |
| Literature: Brokke; Christensen Journal of Organic Chemistry, 1959 , vol. 24, p. 523,525 |
|
~%
2,3,4-trichloro... CAS#:7494-70-4 |
| Literature: Brokke; Christensen Journal of Organic Chemistry, 1959 , vol. 24, p. 523,525 |
|
~%
2,3,4-trichloro... CAS#:7494-70-4 |
| Literature: Brokke; Christensen Journal of Organic Chemistry, 1959 , vol. 24, p. 523,525 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 2,3,4-Trichlor-9-methoxy-2,3-dihydro-furo[3,2-g]chromen-7-on |
| 2,3,4-trichloro-9-methoxy-2,3-dihydro-furo[3,2-g]chromen-7-one |