3-Furanacetic acid,tetrahydro-5-oxo-2,2-diphenyl- structure
|
Common Name | 3-Furanacetic acid,tetrahydro-5-oxo-2,2-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 7496-07-3 | Molecular Weight | 296.31700 | |
| Density | 1.259g/cm3 | Boiling Point | 535.2ºC at 760mmHg | |
| Molecular Formula | C18H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 2-(5-oxo-2,2-diphenyloxolan-3-yl)acetic acid |
|---|
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 535.2ºC at 760mmHg |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.31700 |
| Flash Point | 199.4ºC |
| Exact Mass | 296.10500 |
| PSA | 63.60000 |
| LogP | 2.96800 |
| Index of Refraction | 1.594 |
| InChIKey | KFTQXWDBCLEMEB-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1CC(=O)OC1(c1ccccc1)c1ccccc1 |
|
~%
3-Furanacetic a... CAS#:7496-07-3 |
| Literature: Newman; Joshel; Wise Journal of the American Chemical Society, 1940 , vol. 62, p. 1861 |
|
~%
3-Furanacetic a... CAS#:7496-07-3 |
| Literature: Newman; Joshel; Wise Journal of the American Chemical Society, 1940 , vol. 62, p. 1861 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |