1,2,4-Thiadiazolidin-3-one,2-(1,1-dimethylethyl)-, 1,1-dioxide structure
|
Common Name | 1,2,4-Thiadiazolidin-3-one,2-(1,1-dimethylethyl)-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 74965-49-4 | Molecular Weight | 192.23600 | |
| Density | 1.324g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H12N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-tert-butyl-1,1-dioxo-1,2,4-thiadiazolidin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.23600 |
| Exact Mass | 192.05700 |
| PSA | 74.86000 |
| LogP | 1.44490 |
| Index of Refraction | 1.521 |
| InChIKey | FYAJSTPRTOWXTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)NCS1(=O)=O |
|
~%
1,2,4-Thiadiazo... CAS#:74965-49-4 |
| Literature: Gilmore, W. Franklin; Yeh, Yeong-Maw; Smith, Ricky B. Journal of Organic Chemistry, 1980 , vol. 45, # 23 p. 4784 - 4785 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-tert-butyl-1,2,4-thiadiazolin-3-one-1,1-dioxide |