2,5-bis[(4-methylphenyl)sulfonylmethyl]-1,4-dioxane
Modify Date: 2025-11-09 13:56:32
![2,5-bis[(4-methylphenyl)sulfonylmethyl]-1,4-dioxane Structure](https://image.chemsrc.com/caspic/327/7497-34-9.png)
2,5-bis[(4-methylphenyl)sulfonylmethyl]-1,4-dioxane structure
|
Common Name | 2,5-bis[(4-methylphenyl)sulfonylmethyl]-1,4-dioxane | ||
|---|---|---|---|---|
| CAS Number | 7497-34-9 | Molecular Weight | 424.53100 | |
| Density | 1.265g/cm3 | Boiling Point | 656ºC at 760 mmHg | |
| Molecular Formula | C20H24O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.5ºC | |
| Name | 2,5-bis[(4-methylphenyl)sulfonylmethyl]-1,4-dioxane |
|---|
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 656ºC at 760 mmHg |
| Molecular Formula | C20H24O6S2 |
| Molecular Weight | 424.53100 |
| Flash Point | 350.5ºC |
| Exact Mass | 424.10100 |
| PSA | 103.50000 |
| LogP | 4.49660 |
| Index of Refraction | 1.553 |
| InChIKey | NFJDGKCAEINPMT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC2COC(CS(=O)(=O)c3ccc(C)cc3)CO2)cc1 |
|
~%
2,5-bis[(4-meth... CAS#:7497-34-9 |
| Literature: Culvenor; Davies; Savige Journal of the Chemical Society, 1949 , p. 2198,2202 |
|
~%
2,5-bis[(4-meth... CAS#:7497-34-9 |
| Literature: Culvenor; Davies; Savige Journal of the Chemical Society, 1949 , p. 2198,2202 |
|
~%
2,5-bis[(4-meth... CAS#:7497-34-9 |
| Literature: Culvenor; Davies; Savige Journal of the Chemical Society, 1949 , p. 2198,2202 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |